About (1S)-1-pyridin-4-yl-1-(1,3-thiazol-2-yl)ethanol
(1S)-1-pyridin-4-yl-1-(1,3-thiazol-2-yl)ethanol (PubChem CID 95850481) has the molecular formula C10H10N2OS
and a molecular weight of 206.27 g/mol. Its IUPAC name is (1S)-1-pyridin-4-yl-1-(1,3-thiazol-2-yl)ethanol.
Molecular Properties
| Compound Name | (1S)-1-pyridin-4-yl-1-(1,3-thiazol-2-yl)ethanol |
| PubChem CID | 95850481 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | (1S)-1-pyridin-4-yl-1-(1,3-thiazol-2-yl)ethanol |
| SMILES | C[C@](O)(c1ccncc1)c1nccs1 |
| InChI | InChI=1S/C10H10N2OS/c1-10(13,9-12-6-7-14-9)8-2-4-11-5-3-8/h2-7,13H,1H3/t10-/m0/s1 |
| InChIKey | OVMWVYBRZFMDSO-JTQLQIEISA-N |
| XLogP | 1.79 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-1-pyridin-4-yl-1-(1,3-thiazol-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-pyridin-4-yl-1-(1,3-thiazol-2-yl)ethanol?
The IUPAC name of (1S)-1-pyridin-4-yl-1-(1,3-thiazol-2-yl)ethanol (CID 95850481) is (1S)-1-pyridin-4-yl-1-(1,3-thiazol-2-yl)ethanol.
What is the SMILES notation for (1S)-1-pyridin-4-yl-1-(1,3-thiazol-2-yl)ethanol?
The canonical SMILES for (1S)-1-pyridin-4-yl-1-(1,3-thiazol-2-yl)ethanol is C[C@](O)(c1ccncc1)c1nccs1.
What is the InChIKey of (1S)-1-pyridin-4-yl-1-(1,3-thiazol-2-yl)ethanol?
The InChIKey is OVMWVYBRZFMDSO-JTQLQIEISA-N. The full InChI is InChI=1S/C10H10N2OS/c1-10(13,9-12-6-7-14-9)8-2-4-11-5-3-8/h2-7,13H,1H3/t10-/m0/s1.
What are the key properties of (1S)-1-pyridin-4-yl-1-(1,3-thiazol-2-yl)ethanol?
(1S)-1-pyridin-4-yl-1-(1,3-thiazol-2-yl)ethanol has a molecular weight of 206.27 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-pyridin-4-yl-1-(1,3-thiazol-2-yl)ethanol is sourced from PubChem (CID 95850481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).