C24H28N4O4 — CID 95852268
(3aS,4S,6aR)-4-(2,4-dimethoxypyrimidin-5-yl)-2-[(8-methoxyquinolin-2-yl)methyl]-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol (PubChem CID 95852268) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-(2,4-dimethoxypyrimidin-5-yl)-2-[(8-methoxyquinolin-2-yl)methyl]-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol.
| Compound Name | (3aS,4S,6aR)-4-(2,4-dimethoxypyrimidin-5-yl)-2-[(8-methoxyquinolin-2-yl)methyl]-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 95852268 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | (3aS,4S,6aR)-4-(2,4-dimethoxypyrimidin-5-yl)-2-[(8-methoxyquinolin-2-yl)methyl]-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
| SMILES | COc1ncc([C@]2(O)CC[C@H]3CN(Cc4ccc5cccc(OC)c5n4)C[C@H]32)c(OC)n1 |
| InChI | InChI=1S/C24H28N4O4/c1-30-20-6-4-5-15-7-8-17(26-21(15)20)13-28-12-16-9-10-24(29,19(16)14-28)18-11-25-23(32-3)27-22(18)31-2/h4-8,11,16,19,29H,9-10,12-14H2,1-3H3/t16-,19+,24+/m0/s1 |
| InChIKey | VTCKGHSLEQDNNX-LSRZYVKLSA-N |
| XLogP | 2.78 |
| TPSA | 89.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |