C25H32N4O3 — CID 95852308
(3aS,4S,6aR)-4-(2,4-diethoxypyrimidin-5-yl)-2-[(1-methylindol-3-yl)methyl]-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol (PubChem CID 95852308) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-(2,4-diethoxypyrimidin-5-yl)-2-[(1-methylindol-3-yl)methyl]-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol.
| Compound Name | (3aS,4S,6aR)-4-(2,4-diethoxypyrimidin-5-yl)-2-[(1-methylindol-3-yl)methyl]-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 95852308 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | (3aS,4S,6aR)-4-(2,4-diethoxypyrimidin-5-yl)-2-[(1-methylindol-3-yl)methyl]-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
| SMILES | CCOc1ncc([C@]2(O)CC[C@H]3CN(Cc4cn(C)c5ccccc45)C[C@H]32)c(OCC)n1 |
| InChI | InChI=1S/C25H32N4O3/c1-4-31-23-20(12-26-24(27-23)32-5-2)25(30)11-10-17-14-29(16-21(17)25)15-18-13-28(3)22-9-7-6-8-19(18)22/h6-9,12-13,17,21,30H,4-5,10-11,14-16H2,1-3H3/t17-,21+,25+/m0/s1 |
| InChIKey | HEQLCMRDJPRRSJ-SMTRDTIPSA-N |
| XLogP | 3.50 |
| TPSA | 72.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |