C23H26N2O4 — CID 95855330
(3aS,10aS)-2-[(2,6-dimethoxyphenyl)methyl]-4,10a-dimethyl-3,3a-dihydro-1H-pyrrolo[3,4-c][2]benzazepine-5,10-dione (PubChem CID 95855330) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is (3aS,10aS)-2-[(2,6-dimethoxyphenyl)methyl]-4,10a-dimethyl-3,3a-dihydro-1H-pyrrolo[3,4-c][2]benzazepine-5,10-dione.
| Compound Name | (3aS,10aS)-2-[(2,6-dimethoxyphenyl)methyl]-4,10a-dimethyl-3,3a-dihydro-1H-pyrrolo[3,4-c][2]benzazepine-5,10-dione |
|---|---|
| PubChem CID | 95855330 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (3aS,10aS)-2-[(2,6-dimethoxyphenyl)methyl]-4,10a-dimethyl-3,3a-dihydro-1H-pyrrolo[3,4-c][2]benzazepine-5,10-dione |
| SMILES | COc1cccc(OC)c1CN1C[C@H]2N(C)C(=O)c3ccccc3C(=O)[C@@]2(C)C1 |
| InChI | InChI=1S/C23H26N2O4/c1-23-14-25(12-17-18(28-3)10-7-11-19(17)29-4)13-20(23)24(2)22(27)16-9-6-5-8-15(16)21(23)26/h5-11,20H,12-14H2,1-4H3/t20-,23+/m1/s1 |
| InChIKey | SKBHDLUCVXFNHB-OFNKIYASSA-N |
| XLogP | 2.86 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |