C22H17FN4O2 — CID 95856087
11-[(4-fluorophenyl)methyl]-6-methyl-4-phenyl-13-oxa-2,4,5,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraen-12-one (PubChem CID 95856087) has the molecular formula C22H17FN4O2 and a molecular weight of 388.40 g/mol. Its IUPAC name is 11-[(4-fluorophenyl)methyl]-6-methyl-4-phenyl-13-oxa-2,4,5,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraen-12-one.
| Compound Name | 11-[(4-fluorophenyl)methyl]-6-methyl-4-phenyl-13-oxa-2,4,5,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraen-12-one |
|---|---|
| PubChem CID | 95856087 |
| Molecular Formula | C22H17FN4O2 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 11-[(4-fluorophenyl)methyl]-6-methyl-4-phenyl-13-oxa-2,4,5,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraen-12-one |
| SMILES | Cc1nn(-c2ccccc2)c2nc3c(cc12)CN(Cc1ccc(F)cc1)C(=O)O3 |
| InChI | InChI=1S/C22H17FN4O2/c1-14-19-11-16-13-26(12-15-7-9-17(23)10-8-15)22(28)29-21(16)24-20(19)27(25-14)18-5-3-2-4-6-18/h2-11H,12-13H2,1H3 |
| InChIKey | PMYGNZLNRFQQFI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |