C20H25N3O2S — CID 95856405
[(3S)-3-methylpiperidin-1-yl]-(5-morpholin-4-yl-4-pyridin-3-ylthiophen-2-yl)methanone (PubChem CID 95856405) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is [(3S)-3-methylpiperidin-1-yl]-(5-morpholin-4-yl-4-pyridin-3-ylthiophen-2-yl)methanone.
| Compound Name | [(3S)-3-methylpiperidin-1-yl]-(5-morpholin-4-yl-4-pyridin-3-ylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 95856405 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [(3S)-3-methylpiperidin-1-yl]-(5-morpholin-4-yl-4-pyridin-3-ylthiophen-2-yl)methanone |
| SMILES | C[C@H]1CCCN(C(=O)c2cc(-c3cccnc3)c(N3CCOCC3)s2)C1 |
| InChI | InChI=1S/C20H25N3O2S/c1-15-4-3-7-23(14-15)19(24)18-12-17(16-5-2-6-21-13-16)20(26-18)22-8-10-25-11-9-22/h2,5-6,12-13,15H,3-4,7-11,14H2,1H3/t15-/m0/s1 |
| InChIKey | CCMDKERFXWINKZ-HNNXBMFYSA-N |
| XLogP | 3.52 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |