C15H26N4O — CID 95857089
(3R,7R,8aS)-2-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol (PubChem CID 95857089) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is (3R,7R,8aS)-2-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol.
| Compound Name | (3R,7R,8aS)-2-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
|---|---|
| PubChem CID | 95857089 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | (3R,7R,8aS)-2-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
| SMILES | CCn1ncc(CN2C[C@@H]3C[C@@H](O)CN3C[C@H]2C)c1C |
| InChI | InChI=1S/C15H26N4O/c1-4-19-12(3)13(6-16-19)8-17-9-14-5-15(20)10-18(14)7-11(17)2/h6,11,14-15,20H,4-5,7-10H2,1-3H3/t11-,14+,15-/m1/s1 |
| InChIKey | CKZHHNXJTLCSAB-BYCMXARLSA-N |
| XLogP | 0.85 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |