About (6R)-6-phenyl-1,3-thiazinane-2,4-dione
(6R)-6-phenyl-1,3-thiazinane-2,4-dione (PubChem CID 95857118) has the molecular formula C10H9NO2S
and a molecular weight of 207.25 g/mol. Its IUPAC name is (6R)-6-phenyl-1,3-thiazinane-2,4-dione.
Molecular Properties
| Compound Name | (6R)-6-phenyl-1,3-thiazinane-2,4-dione |
| PubChem CID | 95857118 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | (6R)-6-phenyl-1,3-thiazinane-2,4-dione |
| SMILES | O=C1C[C@H](c2ccccc2)SC(=O)N1 |
| InChI | InChI=1S/C10H9NO2S/c12-9-6-8(14-10(13)11-9)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,11,12,13)/t8-/m1/s1 |
| InChIKey | RYUNWBGPJCWGPJ-MRVPVSSYSA-N |
| XLogP | 2.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (6R)-6-phenyl-1,3-thiazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-phenyl-1,3-thiazinane-2,4-dione?
The IUPAC name of (6R)-6-phenyl-1,3-thiazinane-2,4-dione (CID 95857118) is (6R)-6-phenyl-1,3-thiazinane-2,4-dione.
What is the SMILES notation for (6R)-6-phenyl-1,3-thiazinane-2,4-dione?
The canonical SMILES for (6R)-6-phenyl-1,3-thiazinane-2,4-dione is O=C1C[C@H](c2ccccc2)SC(=O)N1.
What is the InChIKey of (6R)-6-phenyl-1,3-thiazinane-2,4-dione?
The InChIKey is RYUNWBGPJCWGPJ-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H9NO2S/c12-9-6-8(14-10(13)11-9)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,11,12,13)/t8-/m1/s1.
What are the key properties of (6R)-6-phenyl-1,3-thiazinane-2,4-dione?
(6R)-6-phenyl-1,3-thiazinane-2,4-dione has a molecular weight of 207.25 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-phenyl-1,3-thiazinane-2,4-dione is sourced from PubChem (CID 95857118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).