About 2-(2-amino-4,5-dimethyl-6-oxopyrimidin-1-yl)-N-cyclohexylacetamide
2-(2-amino-4,5-dimethyl-6-oxopyrimidin-1-yl)-N-cyclohexylacetamide (PubChem CID 95857433) has the molecular formula C14H22N4O2
and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-(2-amino-4,5-dimethyl-6-oxopyrimidin-1-yl)-N-cyclohexylacetamide.
Molecular Properties
| Compound Name | 2-(2-amino-4,5-dimethyl-6-oxopyrimidin-1-yl)-N-cyclohexylacetamide |
| PubChem CID | 95857433 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-(2-amino-4,5-dimethyl-6-oxopyrimidin-1-yl)-N-cyclohexylacetamide |
| SMILES | Cc1nc(N)n(CC(=O)NC2CCCCC2)c(=O)c1C |
| InChI | InChI=1S/C14H22N4O2/c1-9-10(2)16-14(15)18(13(9)20)8-12(19)17-11-6-4-3-5-7-11/h11H,3-8H2,1-2H3,(H2,15,16)(H,17,19) |
| InChIKey | GCZFFQMMNHDKDJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-amino-4,5-dimethyl-6-oxopyrimidin-1-yl)-N-cyclohexylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-4,5-dimethyl-6-oxopyrimidin-1-yl)-N-cyclohexylacetamide?
The IUPAC name of 2-(2-amino-4,5-dimethyl-6-oxopyrimidin-1-yl)-N-cyclohexylacetamide (CID 95857433) is 2-(2-amino-4,5-dimethyl-6-oxopyrimidin-1-yl)-N-cyclohexylacetamide.
What is the SMILES notation for 2-(2-amino-4,5-dimethyl-6-oxopyrimidin-1-yl)-N-cyclohexylacetamide?
The canonical SMILES for 2-(2-amino-4,5-dimethyl-6-oxopyrimidin-1-yl)-N-cyclohexylacetamide is Cc1nc(N)n(CC(=O)NC2CCCCC2)c(=O)c1C.
What is the InChIKey of 2-(2-amino-4,5-dimethyl-6-oxopyrimidin-1-yl)-N-cyclohexylacetamide?
The InChIKey is GCZFFQMMNHDKDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O2/c1-9-10(2)16-14(15)18(13(9)20)8-12(19)17-11-6-4-3-5-7-11/h11H,3-8H2,1-2H3,(H2,15,16)(H,17,19).
What are the key properties of 2-(2-amino-4,5-dimethyl-6-oxopyrimidin-1-yl)-N-cyclohexylacetamide?
2-(2-amino-4,5-dimethyl-6-oxopyrimidin-1-yl)-N-cyclohexylacetamide has a molecular weight of 278.36 g/mol, XLogP of 0.89, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-4,5-dimethyl-6-oxopyrimidin-1-yl)-N-cyclohexylacetamide is sourced from PubChem (CID 95857433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).