C25H27N3O — CID 95858360
[(5aS,8aS)-1-(naphthalen-1-ylmethyl)-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-7-yl]-pyridin-2-ylmethanone (PubChem CID 95858360) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is [(5aS,8aS)-1-(naphthalen-1-ylmethyl)-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-7-yl]-pyridin-2-ylmethanone.
| Compound Name | [(5aS,8aS)-1-(naphthalen-1-ylmethyl)-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-7-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 95858360 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | [(5aS,8aS)-1-(naphthalen-1-ylmethyl)-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-7-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1C[C@@H]2CCCCN(Cc3cccc4ccccc34)[C@@H]2C1 |
| InChI | InChI=1S/C25H27N3O/c29-25(23-13-3-5-14-26-23)28-17-21-9-4-6-15-27(24(21)18-28)16-20-11-7-10-19-8-1-2-12-22(19)20/h1-3,5,7-8,10-14,21,24H,4,6,9,15-18H2/t21-,24+/m0/s1 |
| InChIKey | VXVKRDQSQAFTCB-XUZZJYLKSA-N |
| XLogP | 4.36 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |