About (2S)-1,2-dichloro-3-[(2R)-2,3-dichloropropoxy]propane
(2S)-1,2-dichloro-3-[(2R)-2,3-dichloropropoxy]propane (PubChem CID 95858502) has the molecular formula C6H10Cl4O
and a molecular weight of 239.96 g/mol. Its IUPAC name is (2S)-1,2-dichloro-3-[(2R)-2,3-dichloropropoxy]propane.
Molecular Properties
| Compound Name | (2S)-1,2-dichloro-3-[(2R)-2,3-dichloropropoxy]propane |
| PubChem CID | 95858502 |
| Molecular Formula | C6H10Cl4O |
| Molecular Weight | 239.96 g/mol |
| Exact Mass | 237.95 |
| IUPAC Name | (2S)-1,2-dichloro-3-[(2R)-2,3-dichloropropoxy]propane |
| SMILES | ClC[C@@H](Cl)COC[C@@H](Cl)CCl |
| InChI | InChI=1S/C6H10Cl4O/c7-1-5(9)3-11-4-6(10)2-8/h5-6H,1-4H2/t5-,6+ |
| InChIKey | DWUVEXODBSOVSX-OLQVQODUSA-N |
| XLogP | 2.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.96 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,2-dichloro-3-[(2R)-2,3-dichloropropoxy]propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,2-dichloro-3-[(2R)-2,3-dichloropropoxy]propane?
The IUPAC name of (2S)-1,2-dichloro-3-[(2R)-2,3-dichloropropoxy]propane (CID 95858502) is (2S)-1,2-dichloro-3-[(2R)-2,3-dichloropropoxy]propane.
What is the SMILES notation for (2S)-1,2-dichloro-3-[(2R)-2,3-dichloropropoxy]propane?
The canonical SMILES for (2S)-1,2-dichloro-3-[(2R)-2,3-dichloropropoxy]propane is ClC[C@@H](Cl)COC[C@@H](Cl)CCl.
What is the InChIKey of (2S)-1,2-dichloro-3-[(2R)-2,3-dichloropropoxy]propane?
The InChIKey is DWUVEXODBSOVSX-OLQVQODUSA-N. The full InChI is InChI=1S/C6H10Cl4O/c7-1-5(9)3-11-4-6(10)2-8/h5-6H,1-4H2/t5-,6+.
What are the key properties of (2S)-1,2-dichloro-3-[(2R)-2,3-dichloropropoxy]propane?
(2S)-1,2-dichloro-3-[(2R)-2,3-dichloropropoxy]propane has a molecular weight of 239.96 g/mol, XLogP of 2.70, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,2-dichloro-3-[(2R)-2,3-dichloropropoxy]propane is sourced from PubChem (CID 95858502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).