C13H4Br4Cl6 — CID 95858554
(1R,4S,5R)-1,2,3,4,7,7-hexachloro-5-(2,3,5,6-tetrabromophenyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 95858554) has the molecular formula C13H4Br4Cl6 and a molecular weight of 692.51 g/mol. Its IUPAC name is (1R,4S,5R)-1,2,3,4,7,7-hexachloro-5-(2,3,5,6-tetrabromophenyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | (1R,4S,5R)-1,2,3,4,7,7-hexachloro-5-(2,3,5,6-tetrabromophenyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 95858554 |
| Molecular Formula | C13H4Br4Cl6 |
| Molecular Weight | 692.51 g/mol |
| Exact Mass | 685.52 |
| IUPAC Name | (1R,4S,5R)-1,2,3,4,7,7-hexachloro-5-(2,3,5,6-tetrabromophenyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | ClC1=C(Cl)[C@@]2(Cl)[C@@H](c3c(Br)c(Br)cc(Br)c3Br)C[C@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C13H4Br4Cl6/c14-4-1-5(15)8(17)6(7(4)16)3-2-11(20)9(18)10(19)12(3,21)13(11,22)23/h1,3H,2H2/t3-,11-,12+/m1/s1 |
| InChIKey | MJKPXVLBKDXXCK-AECBJIGTSA-N |
| XLogP | 9.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.51 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|