C23H31N3O5 — CID 95860362
methyl 2-[1-[(3S)-1-(2-benzamidoacetyl)piperidine-3-carbonyl]piperidin-4-yl]acetate (PubChem CID 95860362) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is methyl 2-[1-[(3S)-1-(2-benzamidoacetyl)piperidine-3-carbonyl]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[1-[(3S)-1-(2-benzamidoacetyl)piperidine-3-carbonyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 95860362 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | methyl 2-[1-[(3S)-1-(2-benzamidoacetyl)piperidine-3-carbonyl]piperidin-4-yl]acetate |
| SMILES | COC(=O)CC1CCN(C(=O)[C@H]2CCCN(C(=O)CNC(=O)c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C23H31N3O5/c1-31-21(28)14-17-9-12-25(13-10-17)23(30)19-8-5-11-26(16-19)20(27)15-24-22(29)18-6-3-2-4-7-18/h2-4,6-7,17,19H,5,8-16H2,1H3,(H,24,29)/t19-/m0/s1 |
| InChIKey | SNTDEPJHKKSFMX-IBGZPJMESA-N |
| XLogP | 1.46 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |