C19H12ClFN2O4 — CID 95861282
(9S)-9-(2-chloro-6-fluorophenyl)-5-methyl-2,13,15-trioxa-4,6-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),3(8),4,10,12(16)-pentaen-7-one (PubChem CID 95861282) has the molecular formula C19H12ClFN2O4 and a molecular weight of 386.77 g/mol. Its IUPAC name is (9S)-9-(2-chloro-6-fluorophenyl)-5-methyl-2,13,15-trioxa-4,6-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),3(8),4,10,12(16)-pentaen-7-one.
| Compound Name | (9S)-9-(2-chloro-6-fluorophenyl)-5-methyl-2,13,15-trioxa-4,6-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),3(8),4,10,12(16)-pentaen-7-one |
|---|---|
| PubChem CID | 95861282 |
| Molecular Formula | C19H12ClFN2O4 |
| Molecular Weight | 386.77 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | (9S)-9-(2-chloro-6-fluorophenyl)-5-methyl-2,13,15-trioxa-4,6-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),3(8),4,10,12(16)-pentaen-7-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)[C@@H](c1c(F)cccc1Cl)c1cc3c(cc1O2)OCO3 |
| InChI | InChI=1S/C19H12ClFN2O4/c1-8-22-18(24)17-15(16-10(20)3-2-4-11(16)21)9-5-13-14(26-7-25-13)6-12(9)27-19(17)23-8/h2-6,15H,7H2,1H3,(H,22,23,24)/t15-/m1/s1 |
| InChIKey | CRXVQUGMZZRQGZ-OAHLLOKOSA-N |
| XLogP | 3.89 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.77 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |