C19H24N6O — CID 95861790
5-[(4R)-5-[(3,5-dimethyl-1-prop-2-enylpyrazol-4-yl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-4-yl]-3-methyl-1,2-oxazole (PubChem CID 95861790) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 5-[(4R)-5-[(3,5-dimethyl-1-prop-2-enylpyrazol-4-yl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-4-yl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[(4R)-5-[(3,5-dimethyl-1-prop-2-enylpyrazol-4-yl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-4-yl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 95861790 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 5-[(4R)-5-[(3,5-dimethyl-1-prop-2-enylpyrazol-4-yl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-4-yl]-3-methyl-1,2-oxazole |
| SMILES | C=CCn1nc(C)c(CN2CCc3[nH]cnc3[C@@H]2c2cc(C)no2)c1C |
| InChI | InChI=1S/C19H24N6O/c1-5-7-25-14(4)15(13(3)22-25)10-24-8-6-16-18(21-11-20-16)19(24)17-9-12(2)23-26-17/h5,9,11,19H,1,6-8,10H2,2-4H3,(H,20,21)/t19-/m0/s1 |
| InChIKey | GZICHJYFIQGBEH-IBGZPJMESA-N |
| XLogP | 2.85 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|