C20H27N3O3 — CID 95861990
(4R)-4-(2,2-dimethylpropyl)-5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 95861990) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is (4R)-4-(2,2-dimethylpropyl)-5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | (4R)-4-(2,2-dimethylpropyl)-5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 95861990 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (4R)-4-(2,2-dimethylpropyl)-5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | COc1cc(CN2CCc3[nH]cnc3[C@H]2CC(C)(C)C)cc2c1OCO2 |
| InChI | InChI=1S/C20H27N3O3/c1-20(2,3)9-15-18-14(21-11-22-18)5-6-23(15)10-13-7-16(24-4)19-17(8-13)25-12-26-19/h7-8,11,15H,5-6,9-10,12H2,1-4H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | AMORCOGOTKSOKT-OAHLLOKOSA-N |
| XLogP | 3.68 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |