C17H31N5OS — CID 95861997
4-[[5-[(3R)-1-(2-ethylsulfanylethyl)piperidin-3-yl]-4-methyl-1,2,4-triazol-3-yl]methyl]morpholine (PubChem CID 95861997) has the molecular formula C17H31N5OS and a molecular weight of 353.54 g/mol. Its IUPAC name is 4-[[5-[(3R)-1-(2-ethylsulfanylethyl)piperidin-3-yl]-4-methyl-1,2,4-triazol-3-yl]methyl]morpholine.
| Compound Name | 4-[[5-[(3R)-1-(2-ethylsulfanylethyl)piperidin-3-yl]-4-methyl-1,2,4-triazol-3-yl]methyl]morpholine |
|---|---|
| PubChem CID | 95861997 |
| Molecular Formula | C17H31N5OS |
| Molecular Weight | 353.54 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 4-[[5-[(3R)-1-(2-ethylsulfanylethyl)piperidin-3-yl]-4-methyl-1,2,4-triazol-3-yl]methyl]morpholine |
| SMILES | CCSCCN1CCC[C@@H](c2nnc(CN3CCOCC3)n2C)C1 |
| InChI | InChI=1S/C17H31N5OS/c1-3-24-12-9-21-6-4-5-15(13-21)17-19-18-16(20(17)2)14-22-7-10-23-11-8-22/h15H,3-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | DIUAAAZVDKLSLJ-OAHLLOKOSA-N |
| XLogP | 1.58 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.54 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|