C20H25ClN4O — CID 95862936
(3S)-1-[4-[4-(2-chlorophenyl)piperidin-4-yl]pyrimidin-2-yl]piperidin-3-ol (PubChem CID 95862936) has the molecular formula C20H25ClN4O and a molecular weight of 372.90 g/mol. Its IUPAC name is (3S)-1-[4-[4-(2-chlorophenyl)piperidin-4-yl]pyrimidin-2-yl]piperidin-3-ol.
| Compound Name | (3S)-1-[4-[4-(2-chlorophenyl)piperidin-4-yl]pyrimidin-2-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 95862936 |
| Molecular Formula | C20H25ClN4O |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (3S)-1-[4-[4-(2-chlorophenyl)piperidin-4-yl]pyrimidin-2-yl]piperidin-3-ol |
| SMILES | O[C@H]1CCCN(c2nccc(C3(c4ccccc4Cl)CCNCC3)n2)C1 |
| InChI | InChI=1S/C20H25ClN4O/c21-17-6-2-1-5-16(17)20(8-11-22-12-9-20)18-7-10-23-19(24-18)25-13-3-4-15(26)14-25/h1-2,5-7,10,15,22,26H,3-4,8-9,11-14H2/t15-/m0/s1 |
| InChIKey | ALINOUWNHGHZKT-HNNXBMFYSA-N |
| XLogP | 2.76 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |