C20H17ClN2O2 — CID 95863161
(5-chloro-3-phenyl-1H-indol-2-yl)-[(2S)-2-(hydroxymethyl)-2,5-dihydropyrrol-1-yl]methanone (PubChem CID 95863161) has the molecular formula C20H17ClN2O2 and a molecular weight of 352.82 g/mol. Its IUPAC name is (5-chloro-3-phenyl-1H-indol-2-yl)-[(2S)-2-(hydroxymethyl)-2,5-dihydropyrrol-1-yl]methanone.
| Compound Name | (5-chloro-3-phenyl-1H-indol-2-yl)-[(2S)-2-(hydroxymethyl)-2,5-dihydropyrrol-1-yl]methanone |
|---|---|
| PubChem CID | 95863161 |
| Molecular Formula | C20H17ClN2O2 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | (5-chloro-3-phenyl-1H-indol-2-yl)-[(2S)-2-(hydroxymethyl)-2,5-dihydropyrrol-1-yl]methanone |
| SMILES | O=C(c1[nH]c2ccc(Cl)cc2c1-c1ccccc1)N1CC=C[C@H]1CO |
| InChI | InChI=1S/C20H17ClN2O2/c21-14-8-9-17-16(11-14)18(13-5-2-1-3-6-13)19(22-17)20(25)23-10-4-7-15(23)12-24/h1-9,11,15,22,24H,10,12H2/t15-/m0/s1 |
| InChIKey | HRIXXPPDHNCBLR-HNNXBMFYSA-N |
| XLogP | 3.86 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|