C20H35N5O — CID 95866696
1-[(3R)-3-[4-methyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]hexan-1-one (PubChem CID 95866696) has the molecular formula C20H35N5O and a molecular weight of 361.53 g/mol. Its IUPAC name is 1-[(3R)-3-[4-methyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]hexan-1-one.
| Compound Name | 1-[(3R)-3-[4-methyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 95866696 |
| Molecular Formula | C20H35N5O |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | 1-[(3R)-3-[4-methyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCC[C@@H](c2nnc(CN3CCCCC3)n2C)C1 |
| InChI | InChI=1S/C20H35N5O/c1-3-4-6-11-19(26)25-14-9-10-17(15-25)20-22-21-18(23(20)2)16-24-12-7-5-8-13-24/h17H,3-16H2,1-2H3/t17-/m1/s1 |
| InChIKey | NSHRYFBEOJTQKA-QGZVFWFLSA-N |
| XLogP | 3.09 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|