C19H22N4O2 — CID 95867187
3-methyl-5-[(4R)-5-(2-phenylmethoxyethyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-4-yl]-1,2-oxazole (PubChem CID 95867187) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-methyl-5-[(4R)-5-(2-phenylmethoxyethyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-4-yl]-1,2-oxazole.
| Compound Name | 3-methyl-5-[(4R)-5-(2-phenylmethoxyethyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-4-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 95867187 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 3-methyl-5-[(4R)-5-(2-phenylmethoxyethyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-4-yl]-1,2-oxazole |
| SMILES | Cc1cc([C@H]2c3nc[nH]c3CCN2CCOCc2ccccc2)on1 |
| InChI | InChI=1S/C19H22N4O2/c1-14-11-17(25-22-14)19-18-16(20-13-21-18)7-8-23(19)9-10-24-12-15-5-3-2-4-6-15/h2-6,11,13,19H,7-10,12H2,1H3,(H,20,21)/t19-/m0/s1 |
| InChIKey | UXDIFLMCKWFFCV-IBGZPJMESA-N |
| XLogP | 2.87 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|