About (3R)-1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-3-(hydroxymethyl)piperidin-3-ol
(3R)-1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-3-(hydroxymethyl)piperidin-3-ol (PubChem CID 95867256) has the molecular formula C18H25N3O2
and a molecular weight of 315.42 g/mol. Its IUPAC name is (3R)-1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-3-(hydroxymethyl)piperidin-3-ol.
Molecular Properties
| Compound Name | (3R)-1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-3-(hydroxymethyl)piperidin-3-ol |
| PubChem CID | 95867256 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (3R)-1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-3-(hydroxymethyl)piperidin-3-ol |
| SMILES | Cc1cc(C)c(CN2CCC[C@](O)(CO)C2)c(-n2cccn2)c1 |
| InChI | InChI=1S/C18H25N3O2/c1-14-9-15(2)16(17(10-14)21-8-4-6-19-21)11-20-7-3-5-18(23,12-20)13-22/h4,6,8-10,22-23H,3,5,7,11-13H2,1-2H3/t18-/m1/s1 |
| InChIKey | MOWAGQQSEKRNCS-GOSISDBHSA-N |
| XLogP | 1.81 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R)-1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-3-(hydroxymethyl)piperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-3-(hydroxymethyl)piperidin-3-ol?
The IUPAC name of (3R)-1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-3-(hydroxymethyl)piperidin-3-ol (CID 95867256) is (3R)-1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-3-(hydroxymethyl)piperidin-3-ol.
What is the SMILES notation for (3R)-1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-3-(hydroxymethyl)piperidin-3-ol?
The canonical SMILES for (3R)-1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-3-(hydroxymethyl)piperidin-3-ol is Cc1cc(C)c(CN2CCC[C@](O)(CO)C2)c(-n2cccn2)c1.
What is the InChIKey of (3R)-1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-3-(hydroxymethyl)piperidin-3-ol?
The InChIKey is MOWAGQQSEKRNCS-GOSISDBHSA-N. The full InChI is InChI=1S/C18H25N3O2/c1-14-9-15(2)16(17(10-14)21-8-4-6-19-21)11-20-7-3-5-18(23,12-20)13-22/h4,6,8-10,22-23H,3,5,7,11-13H2,1-2H3/t18-/m1/s1.
What are the key properties of (3R)-1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-3-(hydroxymethyl)piperidin-3-ol?
(3R)-1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-3-(hydroxymethyl)piperidin-3-ol has a molecular weight of 315.42 g/mol, XLogP of 1.81, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-3-(hydroxymethyl)piperidin-3-ol is sourced from PubChem (CID 95867256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).