C20H30FN3O — CID 95867395
(6S)-8-(5-fluoropentyl)-2-(pyridin-2-ylmethyl)-2,8-diazaspiro[5.5]undecan-3-one (PubChem CID 95867395) has the molecular formula C20H30FN3O and a molecular weight of 347.48 g/mol. Its IUPAC name is (6S)-8-(5-fluoropentyl)-2-(pyridin-2-ylmethyl)-2,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | (6S)-8-(5-fluoropentyl)-2-(pyridin-2-ylmethyl)-2,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 95867395 |
| Molecular Formula | C20H30FN3O |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | (6S)-8-(5-fluoropentyl)-2-(pyridin-2-ylmethyl)-2,8-diazaspiro[5.5]undecan-3-one |
| SMILES | O=C1CC[C@]2(CCCN(CCCCCF)C2)CN1Cc1ccccn1 |
| InChI | InChI=1S/C20H30FN3O/c21-11-3-1-5-13-23-14-6-9-20(16-23)10-8-19(25)24(17-20)15-18-7-2-4-12-22-18/h2,4,7,12H,1,3,5-6,8-11,13-17H2/t20-/m0/s1 |
| InChIKey | YFOXCABYKACNPQ-FQEVSTJZSA-N |
| XLogP | 3.43 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|