C18H24N4O3 — CID 95867445
4-[(2S)-2-[[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]oxy]hex-5-enyl]morpholine (PubChem CID 95867445) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-[(2S)-2-[[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]oxy]hex-5-enyl]morpholine.
| Compound Name | 4-[(2S)-2-[[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]oxy]hex-5-enyl]morpholine |
|---|---|
| PubChem CID | 95867445 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 4-[(2S)-2-[[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]oxy]hex-5-enyl]morpholine |
| SMILES | C=CCC[C@@H](CN1CCOCC1)Oc1ccc(-c2nc(C)no2)cn1 |
| InChI | InChI=1S/C18H24N4O3/c1-3-4-5-16(13-22-8-10-23-11-9-22)24-17-7-6-15(12-19-17)18-20-14(2)21-25-18/h3,6-7,12,16H,1,4-5,8-11,13H2,2H3/t16-/m0/s1 |
| InChIKey | BDBRDNSGPJIWSY-INIZCTEOSA-N |
| XLogP | 2.49 |
| TPSA | 73.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|