About (3R)-3-[(pyrazolo[1,5-a]pyridin-3-ylmethylamino)methyl]piperidin-3-ol
(3R)-3-[(pyrazolo[1,5-a]pyridin-3-ylmethylamino)methyl]piperidin-3-ol (PubChem CID 95867584) has the molecular formula C14H20N4O
and a molecular weight of 260.34 g/mol. Its IUPAC name is (3R)-3-[(pyrazolo[1,5-a]pyridin-3-ylmethylamino)methyl]piperidin-3-ol.
Molecular Properties
| Compound Name | (3R)-3-[(pyrazolo[1,5-a]pyridin-3-ylmethylamino)methyl]piperidin-3-ol |
| PubChem CID | 95867584 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (3R)-3-[(pyrazolo[1,5-a]pyridin-3-ylmethylamino)methyl]piperidin-3-ol |
| SMILES | O[C@]1(CNCc2cnn3ccccc23)CCCNC1 |
| InChI | InChI=1S/C14H20N4O/c19-14(5-3-6-15-10-14)11-16-8-12-9-17-18-7-2-1-4-13(12)18/h1-2,4,7,9,15-16,19H,3,5-6,8,10-11H2/t14-/m1/s1 |
| InChIKey | FABNGBZXRSQSGY-CQSZACIVSA-N |
| XLogP | 0.54 |
| TPSA | 61.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R)-3-[(pyrazolo[1,5-a]pyridin-3-ylmethylamino)methyl]piperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[(pyrazolo[1,5-a]pyridin-3-ylmethylamino)methyl]piperidin-3-ol?
The IUPAC name of (3R)-3-[(pyrazolo[1,5-a]pyridin-3-ylmethylamino)methyl]piperidin-3-ol (CID 95867584) is (3R)-3-[(pyrazolo[1,5-a]pyridin-3-ylmethylamino)methyl]piperidin-3-ol.
What is the SMILES notation for (3R)-3-[(pyrazolo[1,5-a]pyridin-3-ylmethylamino)methyl]piperidin-3-ol?
The canonical SMILES for (3R)-3-[(pyrazolo[1,5-a]pyridin-3-ylmethylamino)methyl]piperidin-3-ol is O[C@]1(CNCc2cnn3ccccc23)CCCNC1.
What is the InChIKey of (3R)-3-[(pyrazolo[1,5-a]pyridin-3-ylmethylamino)methyl]piperidin-3-ol?
The InChIKey is FABNGBZXRSQSGY-CQSZACIVSA-N. The full InChI is InChI=1S/C14H20N4O/c19-14(5-3-6-15-10-14)11-16-8-12-9-17-18-7-2-1-4-13(12)18/h1-2,4,7,9,15-16,19H,3,5-6,8,10-11H2/t14-/m1/s1.
What are the key properties of (3R)-3-[(pyrazolo[1,5-a]pyridin-3-ylmethylamino)methyl]piperidin-3-ol?
(3R)-3-[(pyrazolo[1,5-a]pyridin-3-ylmethylamino)methyl]piperidin-3-ol has a molecular weight of 260.34 g/mol, XLogP of 0.54, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[(pyrazolo[1,5-a]pyridin-3-ylmethylamino)methyl]piperidin-3-ol is sourced from PubChem (CID 95867584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).