C16H29N5 — CID 95868473
(2R)-N-ethyl-N,2-dimethyl-N'-(2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)propane-1,3-diamine (PubChem CID 95868473) has the molecular formula C16H29N5 and a molecular weight of 291.44 g/mol. Its IUPAC name is (2R)-N-ethyl-N,2-dimethyl-N'-(2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)propane-1,3-diamine.
| Compound Name | (2R)-N-ethyl-N,2-dimethyl-N'-(2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 95868473 |
| Molecular Formula | C16H29N5 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | (2R)-N-ethyl-N,2-dimethyl-N'-(2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)propane-1,3-diamine |
| SMILES | CCN(C)C[C@H](C)CNc1nc(C)nc2c1CCNCC2 |
| InChI | InChI=1S/C16H29N5/c1-5-21(4)11-12(2)10-18-16-14-6-8-17-9-7-15(14)19-13(3)20-16/h12,17H,5-11H2,1-4H3,(H,18,19,20)/t12-/m1/s1 |
| InChIKey | OVZFJUQURSYGJQ-GFCCVEGCSA-N |
| XLogP | 1.47 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |