About N-[(3S)-1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]-5-ethyl-2-methylpyrimidin-4-amine
N-[(3S)-1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]-5-ethyl-2-methylpyrimidin-4-amine (PubChem CID 95868870) has the molecular formula C21H28N4
and a molecular weight of 336.48 g/mol. Its IUPAC name is N-[(3S)-1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]-5-ethyl-2-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[(3S)-1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]-5-ethyl-2-methylpyrimidin-4-amine |
| PubChem CID | 95868870 |
| Molecular Formula | C21H28N4 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | N-[(3S)-1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]-5-ethyl-2-methylpyrimidin-4-amine |
| SMILES | CCc1cnc(C)nc1N[C@H]1CCCN(C2Cc3ccccc3C2)C1 |
| InChI | InChI=1S/C21H28N4/c1-3-16-13-22-15(2)23-21(16)24-19-9-6-10-25(14-19)20-11-17-7-4-5-8-18(17)12-20/h4-5,7-8,13,19-20H,3,6,9-12,14H2,1-2H3,(H,22,23,24)/t19-/m0/s1 |
| InChIKey | FPVWBAAAMBLZAN-IBGZPJMESA-N |
| XLogP | 3.39 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3S)-1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]-5-ethyl-2-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]-5-ethyl-2-methylpyrimidin-4-amine?
The IUPAC name of N-[(3S)-1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]-5-ethyl-2-methylpyrimidin-4-amine (CID 95868870) is N-[(3S)-1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]-5-ethyl-2-methylpyrimidin-4-amine.
What is the SMILES notation for N-[(3S)-1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]-5-ethyl-2-methylpyrimidin-4-amine?
The canonical SMILES for N-[(3S)-1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]-5-ethyl-2-methylpyrimidin-4-amine is CCc1cnc(C)nc1N[C@H]1CCCN(C2Cc3ccccc3C2)C1.
What is the InChIKey of N-[(3S)-1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]-5-ethyl-2-methylpyrimidin-4-amine?
The InChIKey is FPVWBAAAMBLZAN-IBGZPJMESA-N. The full InChI is InChI=1S/C21H28N4/c1-3-16-13-22-15(2)23-21(16)24-19-9-6-10-25(14-19)20-11-17-7-4-5-8-18(17)12-20/h4-5,7-8,13,19-20H,3,6,9-12,14H2,1-2H3,(H,22,23,24)/t19-/m0/s1.
What are the key properties of N-[(3S)-1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]-5-ethyl-2-methylpyrimidin-4-amine?
N-[(3S)-1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]-5-ethyl-2-methylpyrimidin-4-amine has a molecular weight of 336.48 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-1-(2,3-dihydro-1H-inden-2-yl)piperidin-3-yl]-5-ethyl-2-methylpyrimidin-4-amine is sourced from PubChem (CID 95868870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).