C20H32N6 — CID 95869797
4-N-(cyclohexen-1-ylmethyl)-7-[(3S)-piperidin-3-yl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 95869797) has the molecular formula C20H32N6 and a molecular weight of 356.52 g/mol. Its IUPAC name is 4-N-(cyclohexen-1-ylmethyl)-7-[(3S)-piperidin-3-yl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-(cyclohexen-1-ylmethyl)-7-[(3S)-piperidin-3-yl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 95869797 |
| Molecular Formula | C20H32N6 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 4-N-(cyclohexen-1-ylmethyl)-7-[(3S)-piperidin-3-yl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | Nc1nc2c(c(NCC3=CCCCC3)n1)CCN([C@H]1CCCNC1)CC2 |
| InChI | InChI=1S/C20H32N6/c21-20-24-18-9-12-26(16-7-4-10-22-14-16)11-8-17(18)19(25-20)23-13-15-5-2-1-3-6-15/h5,16,22H,1-4,6-14H2,(H3,21,23,24,25)/t16-/m0/s1 |
| InChIKey | SFBQHXLQBSDTIL-INIZCTEOSA-N |
| XLogP | 2.12 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|