About 5-[(2R)-1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yl]oxypyridine-2-carbonitrile
5-[(2R)-1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yl]oxypyridine-2-carbonitrile (PubChem CID 95870616) has the molecular formula C18H26N4O
and a molecular weight of 314.43 g/mol. Its IUPAC name is 5-[(2R)-1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yl]oxypyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[(2R)-1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yl]oxypyridine-2-carbonitrile |
| PubChem CID | 95870616 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 5-[(2R)-1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yl]oxypyridine-2-carbonitrile |
| SMILES | C=CCC[C@H](CN1CCCN(C)CC1)Oc1ccc(C#N)nc1 |
| InChI | InChI=1S/C18H26N4O/c1-3-4-6-18(15-22-10-5-9-21(2)11-12-22)23-17-8-7-16(13-19)20-14-17/h3,7-8,14,18H,1,4-6,9-12,15H2,2H3/t18-/m1/s1 |
| InChIKey | YZWCXPDTRIADQD-GOSISDBHSA-N |
| XLogP | 2.30 |
| TPSA | 52.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2R)-1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yl]oxypyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2R)-1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yl]oxypyridine-2-carbonitrile?
The IUPAC name of 5-[(2R)-1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yl]oxypyridine-2-carbonitrile (CID 95870616) is 5-[(2R)-1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yl]oxypyridine-2-carbonitrile.
What is the SMILES notation for 5-[(2R)-1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yl]oxypyridine-2-carbonitrile?
The canonical SMILES for 5-[(2R)-1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yl]oxypyridine-2-carbonitrile is C=CCC[C@H](CN1CCCN(C)CC1)Oc1ccc(C#N)nc1.
What is the InChIKey of 5-[(2R)-1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yl]oxypyridine-2-carbonitrile?
The InChIKey is YZWCXPDTRIADQD-GOSISDBHSA-N. The full InChI is InChI=1S/C18H26N4O/c1-3-4-6-18(15-22-10-5-9-21(2)11-12-22)23-17-8-7-16(13-19)20-14-17/h3,7-8,14,18H,1,4-6,9-12,15H2,2H3/t18-/m1/s1.
What are the key properties of 5-[(2R)-1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yl]oxypyridine-2-carbonitrile?
5-[(2R)-1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yl]oxypyridine-2-carbonitrile has a molecular weight of 314.43 g/mol, XLogP of 2.30, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2R)-1-(4-methyl-1,4-diazepan-1-yl)hex-5-en-2-yl]oxypyridine-2-carbonitrile is sourced from PubChem (CID 95870616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).