About 1-(4,4-difluoropiperidin-1-yl)-2-[(3R)-4-(thiophen-3-ylmethyl)morpholin-3-yl]ethanone
1-(4,4-difluoropiperidin-1-yl)-2-[(3R)-4-(thiophen-3-ylmethyl)morpholin-3-yl]ethanone (PubChem CID 95870788) has the molecular formula C16H22F2N2O2S
and a molecular weight of 344.43 g/mol. Its IUPAC name is 1-(4,4-difluoropiperidin-1-yl)-2-[(3R)-4-(thiophen-3-ylmethyl)morpholin-3-yl]ethanone.
Molecular Properties
| Compound Name | 1-(4,4-difluoropiperidin-1-yl)-2-[(3R)-4-(thiophen-3-ylmethyl)morpholin-3-yl]ethanone |
| PubChem CID | 95870788 |
| Molecular Formula | C16H22F2N2O2S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 1-(4,4-difluoropiperidin-1-yl)-2-[(3R)-4-(thiophen-3-ylmethyl)morpholin-3-yl]ethanone |
| SMILES | O=C(C[C@@H]1COCCN1Cc1ccsc1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C16H22F2N2O2S/c17-16(18)2-4-19(5-3-16)15(21)9-14-11-22-7-6-20(14)10-13-1-8-23-12-13/h1,8,12,14H,2-7,9-11H2/t14-/m1/s1 |
| InChIKey | XSVIEOKVBJQKAT-CQSZACIVSA-N |
| XLogP | 2.60 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4,4-difluoropiperidin-1-yl)-2-[(3R)-4-(thiophen-3-ylmethyl)morpholin-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-difluoropiperidin-1-yl)-2-[(3R)-4-(thiophen-3-ylmethyl)morpholin-3-yl]ethanone?
The IUPAC name of 1-(4,4-difluoropiperidin-1-yl)-2-[(3R)-4-(thiophen-3-ylmethyl)morpholin-3-yl]ethanone (CID 95870788) is 1-(4,4-difluoropiperidin-1-yl)-2-[(3R)-4-(thiophen-3-ylmethyl)morpholin-3-yl]ethanone.
What is the SMILES notation for 1-(4,4-difluoropiperidin-1-yl)-2-[(3R)-4-(thiophen-3-ylmethyl)morpholin-3-yl]ethanone?
The canonical SMILES for 1-(4,4-difluoropiperidin-1-yl)-2-[(3R)-4-(thiophen-3-ylmethyl)morpholin-3-yl]ethanone is O=C(C[C@@H]1COCCN1Cc1ccsc1)N1CCC(F)(F)CC1.
What is the InChIKey of 1-(4,4-difluoropiperidin-1-yl)-2-[(3R)-4-(thiophen-3-ylmethyl)morpholin-3-yl]ethanone?
The InChIKey is XSVIEOKVBJQKAT-CQSZACIVSA-N. The full InChI is InChI=1S/C16H22F2N2O2S/c17-16(18)2-4-19(5-3-16)15(21)9-14-11-22-7-6-20(14)10-13-1-8-23-12-13/h1,8,12,14H,2-7,9-11H2/t14-/m1/s1.
What are the key properties of 1-(4,4-difluoropiperidin-1-yl)-2-[(3R)-4-(thiophen-3-ylmethyl)morpholin-3-yl]ethanone?
1-(4,4-difluoropiperidin-1-yl)-2-[(3R)-4-(thiophen-3-ylmethyl)morpholin-3-yl]ethanone has a molecular weight of 344.43 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-difluoropiperidin-1-yl)-2-[(3R)-4-(thiophen-3-ylmethyl)morpholin-3-yl]ethanone is sourced from PubChem (CID 95870788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).