C19H33N7 — CID 95871486
7-(2-aminoethyl)-2-N-cyclopropyl-4-N-[(3S)-1-methylpiperidin-3-yl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 95871486) has the molecular formula C19H33N7 and a molecular weight of 359.52 g/mol. Its IUPAC name is 7-(2-aminoethyl)-2-N-cyclopropyl-4-N-[(3S)-1-methylpiperidin-3-yl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 7-(2-aminoethyl)-2-N-cyclopropyl-4-N-[(3S)-1-methylpiperidin-3-yl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 95871486 |
| Molecular Formula | C19H33N7 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | 7-(2-aminoethyl)-2-N-cyclopropyl-4-N-[(3S)-1-methylpiperidin-3-yl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | CN1CCC[C@H](Nc2nc(NC3CC3)nc3c2CCN(CCN)CC3)C1 |
| InChI | InChI=1S/C19H33N7/c1-25-9-2-3-15(13-25)21-18-16-6-10-26(12-8-20)11-7-17(16)23-19(24-18)22-14-4-5-14/h14-15H,2-13,20H2,1H3,(H2,21,22,23,24)/t15-/m0/s1 |
| InChIKey | VLAOXZYBXJVDME-HNNXBMFYSA-N |
| XLogP | 0.92 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |