C13H21F3N4O — CID 95871654
(3R)-3-[[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethylamino]methyl]piperidin-3-ol (PubChem CID 95871654) has the molecular formula C13H21F3N4O and a molecular weight of 306.33 g/mol. Its IUPAC name is (3R)-3-[[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethylamino]methyl]piperidin-3-ol.
| Compound Name | (3R)-3-[[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethylamino]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 95871654 |
| Molecular Formula | C13H21F3N4O |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (3R)-3-[[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethylamino]methyl]piperidin-3-ol |
| SMILES | Cc1cc(C(F)(F)F)nn1CCNC[C@@]1(O)CCCNC1 |
| InChI | InChI=1S/C13H21F3N4O/c1-10-7-11(13(14,15)16)19-20(10)6-5-18-9-12(21)3-2-4-17-8-12/h7,17-18,21H,2-6,8-9H2,1H3/t12-/m1/s1 |
| InChIKey | RYMKJWZPSQUDTE-GFCCVEGCSA-N |
| XLogP | 0.91 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|