About (3R)-1-(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)piperidine-3-carbonitrile
(3R)-1-(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)piperidine-3-carbonitrile (PubChem CID 95871825) has the molecular formula C16H21N5
and a molecular weight of 283.38 g/mol. Its IUPAC name is (3R)-1-(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)piperidine-3-carbonitrile.
Molecular Properties
| Compound Name | (3R)-1-(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)piperidine-3-carbonitrile |
| PubChem CID | 95871825 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | (3R)-1-(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)piperidine-3-carbonitrile |
| SMILES | CCc1cc(N2CCC[C@@H](C#N)C2)n2nc(C)c(C)c2n1 |
| InChI | InChI=1S/C16H21N5/c1-4-14-8-15(20-7-5-6-13(9-17)10-20)21-16(18-14)11(2)12(3)19-21/h8,13H,4-7,10H2,1-3H3/t13-/m0/s1 |
| InChIKey | XOJLVENGLJRNGT-ZDUSSCGKSA-N |
| XLogP | 2.65 |
| TPSA | 57.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R)-1-(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)piperidine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)piperidine-3-carbonitrile?
The IUPAC name of (3R)-1-(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)piperidine-3-carbonitrile (CID 95871825) is (3R)-1-(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)piperidine-3-carbonitrile.
What is the SMILES notation for (3R)-1-(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)piperidine-3-carbonitrile?
The canonical SMILES for (3R)-1-(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)piperidine-3-carbonitrile is CCc1cc(N2CCC[C@@H](C#N)C2)n2nc(C)c(C)c2n1.
What is the InChIKey of (3R)-1-(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)piperidine-3-carbonitrile?
The InChIKey is XOJLVENGLJRNGT-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H21N5/c1-4-14-8-15(20-7-5-6-13(9-17)10-20)21-16(18-14)11(2)12(3)19-21/h8,13H,4-7,10H2,1-3H3/t13-/m0/s1.
What are the key properties of (3R)-1-(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)piperidine-3-carbonitrile?
(3R)-1-(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)piperidine-3-carbonitrile has a molecular weight of 283.38 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)piperidine-3-carbonitrile is sourced from PubChem (CID 95871825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).