C13H20N4O4 — CID 95872364
2-hydroxy-N-[2-[(2R)-4-(1-methyl-6-oxopyridazin-4-yl)morpholin-2-yl]ethyl]acetamide (PubChem CID 95872364) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-hydroxy-N-[2-[(2R)-4-(1-methyl-6-oxopyridazin-4-yl)morpholin-2-yl]ethyl]acetamide.
| Compound Name | 2-hydroxy-N-[2-[(2R)-4-(1-methyl-6-oxopyridazin-4-yl)morpholin-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 95872364 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-hydroxy-N-[2-[(2R)-4-(1-methyl-6-oxopyridazin-4-yl)morpholin-2-yl]ethyl]acetamide |
| SMILES | Cn1ncc(N2CCO[C@H](CCNC(=O)CO)C2)cc1=O |
| InChI | InChI=1S/C13H20N4O4/c1-16-13(20)6-10(7-15-16)17-4-5-21-11(8-17)2-3-14-12(19)9-18/h6-7,11,18H,2-5,8-9H2,1H3,(H,14,19)/t11-/m1/s1 |
| InChIKey | SDNAOTBGFUJBBI-LLVKDONJSA-N |
| XLogP | -1.52 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |