C18H28N4O4 — CID 95874096
6-[[(6S)-2-(3-methoxypropyl)-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl]methyl]-1H-pyrimidine-2,4-dione (PubChem CID 95874096) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 6-[[(6S)-2-(3-methoxypropyl)-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl]methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[[(6S)-2-(3-methoxypropyl)-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl]methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 95874096 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 6-[[(6S)-2-(3-methoxypropyl)-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl]methyl]-1H-pyrimidine-2,4-dione |
| SMILES | COCCCN1C[C@@]2(CCCN(Cc3cc(=O)[nH]c(=O)[nH]3)C2)CCC1=O |
| InChI | InChI=1S/C18H28N4O4/c1-26-9-3-8-22-13-18(6-4-16(22)24)5-2-7-21(12-18)11-14-10-15(23)20-17(25)19-14/h10H,2-9,11-13H2,1H3,(H2,19,20,23,25)/t18-/m0/s1 |
| InChIKey | PXZJHFLOKHZSDQ-SFHVURJKSA-N |
| XLogP | 0.30 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|