C18H23N5O2S — CID 95877228
N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-pyridin-4-yl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine (PubChem CID 95877228) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-pyridin-4-yl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine.
| Compound Name | N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-pyridin-4-yl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 95877228 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-pyridin-4-yl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
| SMILES | O=S1(=O)CC[C@H](CNc2nc(-c3ccncc3)nc3c2CCNCC3)C1 |
| InChI | InChI=1S/C18H23N5O2S/c24-26(25)10-5-13(12-26)11-21-18-15-3-8-20-9-4-16(15)22-17(23-18)14-1-6-19-7-2-14/h1-2,6-7,13,20H,3-5,8-12H2,(H,21,22,23)/t13-/m1/s1 |
| InChIKey | VQUBKTOJUQHVRL-CYBMUJFWSA-N |
| XLogP | 1.07 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |