C17H21NO5 — CID 95880890
1-[(3R)-oxolane-3-carbonyl]-4-phenoxypiperidine-4-carboxylic acid (PubChem CID 95880890) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-[(3R)-oxolane-3-carbonyl]-4-phenoxypiperidine-4-carboxylic acid.
| Compound Name | 1-[(3R)-oxolane-3-carbonyl]-4-phenoxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 95880890 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-[(3R)-oxolane-3-carbonyl]-4-phenoxypiperidine-4-carboxylic acid |
| SMILES | O=C([C@@H]1CCOC1)N1CCC(Oc2ccccc2)(C(=O)O)CC1 |
| InChI | InChI=1S/C17H21NO5/c19-15(13-6-11-22-12-13)18-9-7-17(8-10-18,16(20)21)23-14-4-2-1-3-5-14/h1-5,13H,6-12H2,(H,20,21)/t13-/m1/s1 |
| InChIKey | FPMWVTWFTVEUBU-CYBMUJFWSA-N |
| XLogP | 1.55 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |