C17H25N3O2 — CID 95885912
1-[[(1S)-cyclohex-3-en-1-yl]methyl]-4-(2-methylimidazol-1-yl)piperidine-4-carboxylic acid (PubChem CID 95885912) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[[(1S)-cyclohex-3-en-1-yl]methyl]-4-(2-methylimidazol-1-yl)piperidine-4-carboxylic acid.
| Compound Name | 1-[[(1S)-cyclohex-3-en-1-yl]methyl]-4-(2-methylimidazol-1-yl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 95885912 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1-[[(1S)-cyclohex-3-en-1-yl]methyl]-4-(2-methylimidazol-1-yl)piperidine-4-carboxylic acid |
| SMILES | Cc1nccn1C1(C(=O)O)CCN(C[C@@H]2CC=CCC2)CC1 |
| InChI | InChI=1S/C17H25N3O2/c1-14-18-9-12-20(14)17(16(21)22)7-10-19(11-8-17)13-15-5-3-2-4-6-15/h2-3,9,12,15H,4-8,10-11,13H2,1H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | CNDOGILBRNYAQE-OAHLLOKOSA-N |
| XLogP | 2.42 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|