About 3-[[2-[(4S)-2,2-dimethyloxan-4-yl]imidazol-1-yl]methyl]benzoic acid
3-[[2-[(4S)-2,2-dimethyloxan-4-yl]imidazol-1-yl]methyl]benzoic acid (PubChem CID 95886616) has the molecular formula C18H22N2O3
and a molecular weight of 314.38 g/mol. Its IUPAC name is 3-[[2-[(4S)-2,2-dimethyloxan-4-yl]imidazol-1-yl]methyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[[2-[(4S)-2,2-dimethyloxan-4-yl]imidazol-1-yl]methyl]benzoic acid |
| PubChem CID | 95886616 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-[[2-[(4S)-2,2-dimethyloxan-4-yl]imidazol-1-yl]methyl]benzoic acid |
| SMILES | CC1(C)C[C@@H](c2nccn2Cc2cccc(C(=O)O)c2)CCO1 |
| InChI | InChI=1S/C18H22N2O3/c1-18(2)11-15(6-9-23-18)16-19-7-8-20(16)12-13-4-3-5-14(10-13)17(21)22/h3-5,7-8,10,15H,6,9,11-12H2,1-2H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | DSEMIBWGNVRZBP-HNNXBMFYSA-N |
| XLogP | 3.30 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[2-[(4S)-2,2-dimethyloxan-4-yl]imidazol-1-yl]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-[(4S)-2,2-dimethyloxan-4-yl]imidazol-1-yl]methyl]benzoic acid?
The IUPAC name of 3-[[2-[(4S)-2,2-dimethyloxan-4-yl]imidazol-1-yl]methyl]benzoic acid (CID 95886616) is 3-[[2-[(4S)-2,2-dimethyloxan-4-yl]imidazol-1-yl]methyl]benzoic acid.
What is the SMILES notation for 3-[[2-[(4S)-2,2-dimethyloxan-4-yl]imidazol-1-yl]methyl]benzoic acid?
The canonical SMILES for 3-[[2-[(4S)-2,2-dimethyloxan-4-yl]imidazol-1-yl]methyl]benzoic acid is CC1(C)C[C@@H](c2nccn2Cc2cccc(C(=O)O)c2)CCO1.
What is the InChIKey of 3-[[2-[(4S)-2,2-dimethyloxan-4-yl]imidazol-1-yl]methyl]benzoic acid?
The InChIKey is DSEMIBWGNVRZBP-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H22N2O3/c1-18(2)11-15(6-9-23-18)16-19-7-8-20(16)12-13-4-3-5-14(10-13)17(21)22/h3-5,7-8,10,15H,6,9,11-12H2,1-2H3,(H,21,22)/t15-/m0/s1.
What are the key properties of 3-[[2-[(4S)-2,2-dimethyloxan-4-yl]imidazol-1-yl]methyl]benzoic acid?
3-[[2-[(4S)-2,2-dimethyloxan-4-yl]imidazol-1-yl]methyl]benzoic acid has a molecular weight of 314.38 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-[(4S)-2,2-dimethyloxan-4-yl]imidazol-1-yl]methyl]benzoic acid is sourced from PubChem (CID 95886616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).