methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate

C13H14N4O2S — CID 958878

IUPACmethyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate
SMILESCOC(=O)c1ccc(CSc2nc(N)cc(N)n2)cc1
InChIInChI=1S/C13H14N4O2S/c1-19-12(18)9-4-2-8(3-5-9)7-20-13-16-10(14)6-11(15)17-13/h2-6H,7H2,1H3,(H4,14,15,16,17)
InChIKeyLGOUGJBIFOBRRV-UHFFFAOYSA-N
MW290.35 g/mol
LogP1.72
Rot. Bonds4

About methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate

methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate (PubChem CID 958878) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate.

Molecular Properties

Compound Namemethyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate
PubChem CID958878
Molecular FormulaC13H14N4O2S
Molecular Weight290.35 g/mol
Exact Mass290.08
IUPAC Namemethyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate
SMILESCOC(=O)c1ccc(CSc2nc(N)cc(N)n2)cc1
InChIInChI=1S/C13H14N4O2S/c1-19-12(18)9-4-2-8(3-5-9)7-20-13-16-10(14)6-11(15)17-13/h2-6H,7H2,1H3,(H4,14,15,16,17)
InChIKeyLGOUGJBIFOBRRV-UHFFFAOYSA-N
XLogP1.72
TPSA104.12 Ų
H-Bond Donors2
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.35
LogP ≤ 51.72
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 107

Analyze methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate?
The IUPAC name of methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate (CID 958878) is methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate.
What is the SMILES notation for methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate?
The canonical SMILES for methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate is COC(=O)c1ccc(CSc2nc(N)cc(N)n2)cc1.
What is the InChIKey of methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate?
The InChIKey is LGOUGJBIFOBRRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O2S/c1-19-12(18)9-4-2-8(3-5-9)7-20-13-16-10(14)6-11(15)17-13/h2-6H,7H2,1H3,(H4,14,15,16,17).
What are the key properties of methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate?
methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate has a molecular weight of 290.35 g/mol, XLogP of 1.72, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate is sourced from PubChem (CID 958878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).