About methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate
methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate (PubChem CID 958878) has the molecular formula C13H14N4O2S
and a molecular weight of 290.35 g/mol. Its IUPAC name is methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate |
| PubChem CID | 958878 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSc2nc(N)cc(N)n2)cc1 |
| InChI | InChI=1S/C13H14N4O2S/c1-19-12(18)9-4-2-8(3-5-9)7-20-13-16-10(14)6-11(15)17-13/h2-6H,7H2,1H3,(H4,14,15,16,17) |
| InChIKey | LGOUGJBIFOBRRV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate?
The IUPAC name of methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate (CID 958878) is methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate.
What is the SMILES notation for methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate?
The canonical SMILES for methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate is COC(=O)c1ccc(CSc2nc(N)cc(N)n2)cc1.
What is the InChIKey of methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate?
The InChIKey is LGOUGJBIFOBRRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O2S/c1-19-12(18)9-4-2-8(3-5-9)7-20-13-16-10(14)6-11(15)17-13/h2-6H,7H2,1H3,(H4,14,15,16,17).
What are the key properties of methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate?
methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate has a molecular weight of 290.35 g/mol, XLogP of 1.72, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]benzoate is sourced from PubChem (CID 958878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).