C20H29N3O — CID 95889064
(3R)-1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3-[(3-methylphenoxy)methyl]piperidine (PubChem CID 95889064) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is (3R)-1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3-[(3-methylphenoxy)methyl]piperidine.
| Compound Name | (3R)-1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3-[(3-methylphenoxy)methyl]piperidine |
|---|---|
| PubChem CID | 95889064 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | (3R)-1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-3-[(3-methylphenoxy)methyl]piperidine |
| SMILES | CCn1cc(CN2CCC[C@@H](COc3cccc(C)c3)C2)c(C)n1 |
| InChI | InChI=1S/C20H29N3O/c1-4-23-14-19(17(3)21-23)13-22-10-6-8-18(12-22)15-24-20-9-5-7-16(2)11-20/h5,7,9,11,14,18H,4,6,8,10,12-13,15H2,1-3H3/t18-/m1/s1 |
| InChIKey | GTHRSONEBHVHOT-GOSISDBHSA-N |
| XLogP | 3.81 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |