C21H28N2O — CID 95889349
(3R)-3-[(dimethylamino)methyl]-1-(2,2-diphenylethyl)pyrrolidin-3-ol (PubChem CID 95889349) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is (3R)-3-[(dimethylamino)methyl]-1-(2,2-diphenylethyl)pyrrolidin-3-ol.
| Compound Name | (3R)-3-[(dimethylamino)methyl]-1-(2,2-diphenylethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 95889349 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | (3R)-3-[(dimethylamino)methyl]-1-(2,2-diphenylethyl)pyrrolidin-3-ol |
| SMILES | CN(C)C[C@]1(O)CCN(CC(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C21H28N2O/c1-22(2)16-21(24)13-14-23(17-21)15-20(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,20,24H,13-17H2,1-2H3/t21-/m1/s1 |
| InChIKey | ORUOYZONVIYIOA-OAQYLSRUSA-N |
| XLogP | 2.82 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |