C22H26N4O2 — CID 95889414
3-imidazo[1,2-a]pyridin-2-yl-1-[(2R)-4-(4-methoxyphenyl)-2-methylpiperazin-1-yl]propan-1-one (PubChem CID 95889414) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyridin-2-yl-1-[(2R)-4-(4-methoxyphenyl)-2-methylpiperazin-1-yl]propan-1-one.
| Compound Name | 3-imidazo[1,2-a]pyridin-2-yl-1-[(2R)-4-(4-methoxyphenyl)-2-methylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 95889414 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 3-imidazo[1,2-a]pyridin-2-yl-1-[(2R)-4-(4-methoxyphenyl)-2-methylpiperazin-1-yl]propan-1-one |
| SMILES | COc1ccc(N2CCN(C(=O)CCc3cn4ccccc4n3)[C@H](C)C2)cc1 |
| InChI | InChI=1S/C22H26N4O2/c1-17-15-24(19-7-9-20(28-2)10-8-19)13-14-26(17)22(27)11-6-18-16-25-12-4-3-5-21(25)23-18/h3-5,7-10,12,16-17H,6,11,13-15H2,1-2H3/t17-/m1/s1 |
| InChIKey | HZYCRWLKGWTSSC-QGZVFWFLSA-N |
| XLogP | 3.01 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|