About 4-[(2R)-2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane
4-[(2R)-2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane (PubChem CID 95894754) has the molecular formula C19H31N3O2
and a molecular weight of 333.48 g/mol. Its IUPAC name is 4-[(2R)-2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane.
Molecular Properties
| Compound Name | 4-[(2R)-2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane |
| PubChem CID | 95894754 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 4-[(2R)-2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane |
| SMILES | C=CCC[C@H](CN1CCCOCC1)Oc1cc(CCC)nc(C)n1 |
| InChI | InChI=1S/C19H31N3O2/c1-4-6-9-18(15-22-10-7-12-23-13-11-22)24-19-14-17(8-5-2)20-16(3)21-19/h4,14,18H,1,5-13,15H2,2-3H3/t18-/m1/s1 |
| InChIKey | JNNYXOITMNPSPF-GOSISDBHSA-N |
| XLogP | 3.17 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R)-2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane?
The IUPAC name of 4-[(2R)-2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane (CID 95894754) is 4-[(2R)-2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane.
What is the SMILES notation for 4-[(2R)-2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane?
The canonical SMILES for 4-[(2R)-2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane is C=CCC[C@H](CN1CCCOCC1)Oc1cc(CCC)nc(C)n1.
What is the InChIKey of 4-[(2R)-2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane?
The InChIKey is JNNYXOITMNPSPF-GOSISDBHSA-N. The full InChI is InChI=1S/C19H31N3O2/c1-4-6-9-18(15-22-10-7-12-23-13-11-22)24-19-14-17(8-5-2)20-16(3)21-19/h4,14,18H,1,5-13,15H2,2-3H3/t18-/m1/s1.
What are the key properties of 4-[(2R)-2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane?
4-[(2R)-2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane has a molecular weight of 333.48 g/mol, XLogP of 3.17, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane is sourced from PubChem (CID 95894754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).