About 2-[(4S)-2,2-dimethyloxan-4-yl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]imidazole
2-[(4S)-2,2-dimethyloxan-4-yl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]imidazole (PubChem CID 95894779) has the molecular formula C18H28N4O
and a molecular weight of 316.45 g/mol. Its IUPAC name is 2-[(4S)-2,2-dimethyloxan-4-yl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]imidazole.
Molecular Properties
| Compound Name | 2-[(4S)-2,2-dimethyloxan-4-yl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]imidazole |
| PubChem CID | 95894779 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 2-[(4S)-2,2-dimethyloxan-4-yl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]imidazole |
| SMILES | CC(C)Cn1cncc1Cn1ccnc1[C@H]1CCOC(C)(C)C1 |
| InChI | InChI=1S/C18H28N4O/c1-14(2)11-22-13-19-10-16(22)12-21-7-6-20-17(21)15-5-8-23-18(3,4)9-15/h6-7,10,13-15H,5,8-9,11-12H2,1-4H3/t15-/m0/s1 |
| InChIKey | CLWIZTWRGZQTDS-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4S)-2,2-dimethyloxan-4-yl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-2,2-dimethyloxan-4-yl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]imidazole?
The IUPAC name of 2-[(4S)-2,2-dimethyloxan-4-yl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]imidazole (CID 95894779) is 2-[(4S)-2,2-dimethyloxan-4-yl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]imidazole.
What is the SMILES notation for 2-[(4S)-2,2-dimethyloxan-4-yl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]imidazole?
The canonical SMILES for 2-[(4S)-2,2-dimethyloxan-4-yl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]imidazole is CC(C)Cn1cncc1Cn1ccnc1[C@H]1CCOC(C)(C)C1.
What is the InChIKey of 2-[(4S)-2,2-dimethyloxan-4-yl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]imidazole?
The InChIKey is CLWIZTWRGZQTDS-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H28N4O/c1-14(2)11-22-13-19-10-16(22)12-21-7-6-20-17(21)15-5-8-23-18(3,4)9-15/h6-7,10,13-15H,5,8-9,11-12H2,1-4H3/t15-/m0/s1.
What are the key properties of 2-[(4S)-2,2-dimethyloxan-4-yl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]imidazole?
2-[(4S)-2,2-dimethyloxan-4-yl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]imidazole has a molecular weight of 316.45 g/mol, XLogP of 3.46, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-2,2-dimethyloxan-4-yl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]imidazole is sourced from PubChem (CID 95894779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).