C19H25N3O4 — CID 95895034
(5S)-9-[1-(1,3-benzodioxol-5-yl)piperidin-4-yl]-1-oxa-3,9-diazaspiro[4.5]decan-2-one (PubChem CID 95895034) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is (5S)-9-[1-(1,3-benzodioxol-5-yl)piperidin-4-yl]-1-oxa-3,9-diazaspiro[4.5]decan-2-one.
| Compound Name | (5S)-9-[1-(1,3-benzodioxol-5-yl)piperidin-4-yl]-1-oxa-3,9-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 95895034 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (5S)-9-[1-(1,3-benzodioxol-5-yl)piperidin-4-yl]-1-oxa-3,9-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1NC[C@]2(CCCN(C3CCN(c4ccc5c(c4)OCO5)CC3)C2)O1 |
| InChI | InChI=1S/C19H25N3O4/c23-18-20-11-19(26-18)6-1-7-22(12-19)14-4-8-21(9-5-14)15-2-3-16-17(10-15)25-13-24-16/h2-3,10,14H,1,4-9,11-13H2,(H,20,23)/t19-/m0/s1 |
| InChIKey | GNVYOBUWCUGASV-IBGZPJMESA-N |
| XLogP | 1.96 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|