About (3R)-3-[[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol
(3R)-3-[[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol (PubChem CID 95895160) has the molecular formula C14H26N4O
and a molecular weight of 266.39 g/mol. Its IUPAC name is (3R)-3-[[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | (3R)-3-[[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol |
| PubChem CID | 95895160 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | (3R)-3-[[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol |
| SMILES | CCn1nc(C)c(CCNC[C@@]2(O)CCNC2)c1C |
| InChI | InChI=1S/C14H26N4O/c1-4-18-12(3)13(11(2)17-18)5-7-15-9-14(19)6-8-16-10-14/h15-16,19H,4-10H2,1-3H3/t14-/m0/s1 |
| InChIKey | GGZMTXACGQHQDW-AWEZNQCLSA-N |
| XLogP | 0.38 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-[[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol?
The IUPAC name of (3R)-3-[[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol (CID 95895160) is (3R)-3-[[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol.
What is the SMILES notation for (3R)-3-[[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol?
The canonical SMILES for (3R)-3-[[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol is CCn1nc(C)c(CCNC[C@@]2(O)CCNC2)c1C.
What is the InChIKey of (3R)-3-[[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol?
The InChIKey is GGZMTXACGQHQDW-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H26N4O/c1-4-18-12(3)13(11(2)17-18)5-7-15-9-14(19)6-8-16-10-14/h15-16,19H,4-10H2,1-3H3/t14-/m0/s1.
What are the key properties of (3R)-3-[[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol?
(3R)-3-[[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol has a molecular weight of 266.39 g/mol, XLogP of 0.38, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylamino]methyl]pyrrolidin-3-ol is sourced from PubChem (CID 95895160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).