C18H23ClN4O — CID 95895449
(2R)-2-(4-chloropyrazol-1-yl)-1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]propan-1-one (PubChem CID 95895449) has the molecular formula C18H23ClN4O and a molecular weight of 346.86 g/mol. Its IUPAC name is (2R)-2-(4-chloropyrazol-1-yl)-1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]propan-1-one.
| Compound Name | (2R)-2-(4-chloropyrazol-1-yl)-1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 95895449 |
| Molecular Formula | C18H23ClN4O |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (2R)-2-(4-chloropyrazol-1-yl)-1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]propan-1-one |
| SMILES | Cc1cccc(CN2CCN(C(=O)[C@@H](C)n3cc(Cl)cn3)CC2)c1 |
| InChI | InChI=1S/C18H23ClN4O/c1-14-4-3-5-16(10-14)12-21-6-8-22(9-7-21)18(24)15(2)23-13-17(19)11-20-23/h3-5,10-11,13,15H,6-9,12H2,1-2H3/t15-/m1/s1 |
| InChIKey | XZPGXQUFDVGSQS-OAHLLOKOSA-N |
| XLogP | 2.75 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |