C21H30N2O3 — CID 95896359
(6R)-2-benzyl-8-(2-propoxyacetyl)-2,8-diazaspiro[5.5]undecan-3-one (PubChem CID 95896359) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is (6R)-2-benzyl-8-(2-propoxyacetyl)-2,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | (6R)-2-benzyl-8-(2-propoxyacetyl)-2,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 95896359 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | (6R)-2-benzyl-8-(2-propoxyacetyl)-2,8-diazaspiro[5.5]undecan-3-one |
| SMILES | CCCOCC(=O)N1CCC[C@]2(CCC(=O)N(Cc3ccccc3)C2)C1 |
| InChI | InChI=1S/C21H30N2O3/c1-2-13-26-15-20(25)22-12-6-10-21(16-22)11-9-19(24)23(17-21)14-18-7-4-3-5-8-18/h3-5,7-8H,2,6,9-17H2,1H3/t21-/m0/s1 |
| InChIKey | VXDKTGCLYBEKSE-NRFANRHFSA-N |
| XLogP | 2.84 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|