C17H27N7O — CID 95896557
2-(ethoxymethyl)-N-[(1S)-1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine (PubChem CID 95896557) has the molecular formula C17H27N7O and a molecular weight of 345.45 g/mol. Its IUPAC name is 2-(ethoxymethyl)-N-[(1S)-1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine.
| Compound Name | 2-(ethoxymethyl)-N-[(1S)-1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 95896557 |
| Molecular Formula | C17H27N7O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 2-(ethoxymethyl)-N-[(1S)-1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
| SMILES | CCOCc1nc2c(c(N[C@@H](C)c3ncnn3CC)n1)CCNCC2 |
| InChI | InChI=1S/C17H27N7O/c1-4-24-17(19-11-20-24)12(3)21-16-13-6-8-18-9-7-14(13)22-15(23-16)10-25-5-2/h11-12,18H,4-10H2,1-3H3,(H,21,22,23)/t12-/m0/s1 |
| InChIKey | AJUSSYCHHVGWEN-LBPRGKRZSA-N |
| XLogP | 1.49 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |